EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:16586 - 6-aminohexanoic acid
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | NCCCCCC(=O)O |
| InChI | InChI=1S/C6H13NO2/c7-5-3-1-2-4-6(8)9/h1-5,7H2,(H,8,9) |
| InChIKey | SLXKOJJOQWFEFD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hematologic agent Drug that acts on blood and blood-forming organs and those that affect the hemostatic system. antifibrinolytic drug A drug that prevent fibrinolysis or lysis of a blood clot or thrombus. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-aminohexanoic acid (CHEBI:16586) has functional parent hexanoic acid (CHEBI:30776) |
| 6-aminohexanoic acid (CHEBI:16586) has role anti-inflammatory agent (CHEBI:67079) |
| 6-aminohexanoic acid (CHEBI:16586) has role antifibrinolytic drug (CHEBI:48675) |
| 6-aminohexanoic acid (CHEBI:16586) has role hematologic agent (CHEBI:50248) |
| 6-aminohexanoic acid (CHEBI:16586) has role metabolite (CHEBI:25212) |
| 6-aminohexanoic acid (CHEBI:16586) is a ε-amino acid (CHEBI:35958) |
| 6-aminohexanoic acid (CHEBI:16586) is a ω-amino fatty acid (CHEBI:59758) |
| 6-aminohexanoic acid (CHEBI:16586) is conjugate acid of 6-aminohexanoate (CHEBI:32396) |
| 6-aminohexanoic acid (CHEBI:16586) is tautomer of 6-aminohexanoic acid zwitterion (CHEBI:57826) |
| Incoming Relation(s) |
| N-(2,4-dinitrophenyl)aminohexanoic acid (CHEBI:53698) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| N-purin-6-oyl-ε-aminocaproic acid (CHEBI:63086) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| 6-(4-hydroxy-3-nitrobenzamido)hexanoic acid (CHEBI:53077) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| 6-(4-hydroxy-5-iodo-3-nitrobenzamido)hexanoic acid (CHEBI:53087) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| 6-[(3-bromo-4-hydroxy-5-nitrophenyl)acetamido]caproic acid (CHEBI:63483) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| 6-[(4-hydroxy-3-nitrophenyl)acetamido]caproic acid (CHEBI:44604) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| 6-{[5-(p-nitrophenoxy)-5-oxopentanoyl]amino}hexanoic acid (CHEBI:63747) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| 6-aminohexanoic acid cyclic oligomer (CHEBI:133923) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| RG-2833 (CHEBI:233052) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| 6-aminohexanoate (CHEBI:32396) is conjugate base of 6-aminohexanoic acid (CHEBI:16586) |
| 6-aminohexanoic acid zwitterion (CHEBI:57826) is tautomer of 6-aminohexanoic acid (CHEBI:16586) |
| IUPAC Name |
|---|
| 6-aminohexanoic acid |
| INNs | Source |
|---|---|
| acide aminocaproique | WHO MedNet |
| acide aminocaproque | ChemIDplus |
| ácido aminocapróico | ChemIDplus |
| acidum aminocaproicum | ChemIDplus |
| aminocaproic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 177 J.D | ChEMBL |
| 177 J.D. | ChEMBL |
| 177 JD | ChEMBL |
| 177-JD | ChEMBL |
| 6-Aminocaproic acid | KEGG COMPOUND |
| 6-Aminohexanoic acid | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Amicar | ChemIDplus |
| Amikar | ChemIDplus |
| Capralense | ChemIDplus |
| Capramol | ChemIDplus |
| Caproamin | ChEBI |
| Caprocid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 163 | DrugCentral |
| ACA | PDBeChem |
| Aminocaproic_acid | Wikipedia |
| C02378 | KEGG COMPOUND |
| CPD-884 | MetaCyc |
| D00160 | KEGG DRUG |
| DB00513 | DrugBank |
| HMDB0001901 | HMDB |
| LMFA01100035 | LIPID MAPS |
| LSM-5733 | LINCS |
| Citations |
|---|