EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15IN2O6 |
| Net Charge | 0 |
| Average Mass | 422.175 |
| Monoisotopic Mass | 421.99748 |
| SMILES | O=C(O)CCCCCNC(=O)c1cc(I)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15IN2O6/c14-9-6-8(7-10(12(9)19)16(21)22)13(20)15-5-3-1-2-4-11(17)18/h6-7,19H,1-5H2,(H,15,20)(H,17,18) |
| InChIKey | YRSRBWYEXNTPBJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(4-hydroxy-5-iodo-3-nitrobenzamido)hexanoic acid (CHEBI:53087) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| 6-(4-hydroxy-5-iodo-3-nitrobenzamido)hexanoic acid (CHEBI:53087) is a N-acyl-amino acid (CHEBI:51569) |
| 6-(4-hydroxy-5-iodo-3-nitrobenzamido)hexanoic acid (CHEBI:53087) is a 2-nitrophenols (CHEBI:86421) |
| 6-(4-hydroxy-5-iodo-3-nitrobenzamido)hexanoic acid (CHEBI:53087) is a monocarboxylic acid (CHEBI:25384) |
| 6-(4-hydroxy-5-iodo-3-nitrobenzamido)hexanoic acid (CHEBI:53087) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 6-[(4-hydroxy-3-iodo-5-nitrobenzoyl)amino]hexanoic acid |
| Synonym | Source |
|---|---|
| NIP | ChEBI |
| Citations |
|---|