EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O7 |
| Net Charge | 0 |
| Average Mass | 366.370 |
| Monoisotopic Mass | 366.14270 |
| SMILES | O=C(O)CCCCCNC(=O)CCCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H22N2O7/c20-15(18-12-3-1-2-6-16(21)22)5-4-7-17(23)26-14-10-8-13(9-11-14)19(24)25/h8-11H,1-7,12H2,(H,18,20)(H,21,22) |
| InChIKey | JKKVVRPNOCMQNY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-{[5-(p-nitrophenoxy)-5-oxopentanoyl]amino}hexanoic acid (CHEBI:63747) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| 6-{[5-(p-nitrophenoxy)-5-oxopentanoyl]amino}hexanoic acid (CHEBI:63747) is a C-nitro compound (CHEBI:35716) |
| 6-{[5-(p-nitrophenoxy)-5-oxopentanoyl]amino}hexanoic acid (CHEBI:63747) is a carboxylic ester (CHEBI:33308) |
| 6-{[5-(p-nitrophenoxy)-5-oxopentanoyl]amino}hexanoic acid (CHEBI:63747) is a monocarboxylic acid (CHEBI:25384) |
| 6-{[5-(p-nitrophenoxy)-5-oxopentanoyl]amino}hexanoic acid (CHEBI:63747) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 6-{[5-(4-nitrophenoxy)-5-oxopentanoyl]amino}hexanoic acid |
| Synonyms | Source |
|---|---|
| nP-E1 | ChEBI |
| 4-nitrophenyl 5-[(5-carboxypentyl)amino]-5-oxopentanoate | ChEBI |
| Citations |
|---|