EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3O2 |
| Net Charge | 0 |
| Average Mass | 339.439 |
| Monoisotopic Mass | 339.19468 |
| SMILES | Cc1ccc(C(=O)NCCCCCC(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C20H25N3O2/c1-15-10-12-16(13-11-15)20(25)22-14-6-2-3-9-19(24)23-18-8-5-4-7-17(18)21/h4-5,7-8,10-13H,2-3,6,9,14,21H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | VOPDXHFYDJAYNS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RG-2833 (CHEBI:233052) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| RG-2833 (CHEBI:233052) has role antineoplastic agent (CHEBI:35610) |
| RG-2833 (CHEBI:233052) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| RG-2833 (CHEBI:233052) has role nootropic agent (CHEBI:66980) |
| RG-2833 (CHEBI:233052) is a anilide (CHEBI:13248) |
| RG-2833 (CHEBI:233052) is a benzamides (CHEBI:22702) |
| RG-2833 (CHEBI:233052) is a secondary carboxamide (CHEBI:140325) |
| RG-2833 (CHEBI:233052) is a substituted aniline (CHEBI:48975) |
| RG-2833 (CHEBI:233052) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| N-[6-(2-aminoanilino)-6-oxohexyl]-4-methylbenzamide |
| Synonyms | Source |
|---|---|
| RGFP 109 | DrugBank |
| RG 2833 | DrugBank |
| RGFP-109 | DrugBank |
| RGFP109 | DrugBank |
| RG2833 | DrugBank |
| HDACi-109 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB16955 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1215493-56-3 | SUBMITTER |
| Citations |
|---|