EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O6 |
| Net Charge | 0 |
| Average Mass | 296.279 |
| Monoisotopic Mass | 296.10084 |
| SMILES | O=C(O)CCCCCNC(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N2O6/c16-11-6-5-9(8-10(11)15(20)21)13(19)14-7-3-1-2-4-12(17)18/h5-6,8,16H,1-4,7H2,(H,14,19)(H,17,18) |
| InChIKey | VKAIUEFOZOWBMI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(4-hydroxy-3-nitrobenzamido)hexanoic acid (CHEBI:53077) has functional parent 6-aminohexanoic acid (CHEBI:16586) |
| 6-(4-hydroxy-3-nitrobenzamido)hexanoic acid (CHEBI:53077) is a N-acyl-amino acid (CHEBI:51569) |
| 6-(4-hydroxy-3-nitrobenzamido)hexanoic acid (CHEBI:53077) is a 2-nitrophenols (CHEBI:86421) |
| 6-(4-hydroxy-3-nitrobenzamido)hexanoic acid (CHEBI:53077) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 6-[(4-hydroxy-3-nitrobenzoyl)amino]hexanoic acid |
| Citations |
|---|