EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12NO2 |
| Net Charge | -1 |
| Average Mass | 130.167 |
| Monoisotopic Mass | 130.08735 |
| SMILES | NCCCCCC(=O)[O-] |
| InChI | InChI=1S/C6H13NO2/c7-5-3-1-2-4-6(8)9/h1-5,7H2,(H,8,9)/p-1 |
| InChIKey | SLXKOJJOQWFEFD-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-aminohexanoate (CHEBI:32396) has functional parent hexanoate (CHEBI:17120) |
| 6-aminohexanoate (CHEBI:32396) is a amino-acid anion (CHEBI:37022) |
| 6-aminohexanoate (CHEBI:32396) is conjugate base of 6-aminohexanoic acid (CHEBI:16586) |
| 6-aminohexanoate (CHEBI:32396) is conjugate base of 6-aminohexanoic acid zwitterion (CHEBI:57826) |
| Incoming Relation(s) |
| 6-aminohexanoic acid (CHEBI:16586) is conjugate acid of 6-aminohexanoate (CHEBI:32396) |
| 6-aminohexanoic acid zwitterion (CHEBI:57826) is conjugate acid of 6-aminohexanoate (CHEBI:32396) |
| Synonyms | Source |
|---|---|
| 6-amino-n-caproate | UM-BBD |
| 6-Aminohexanoate | KEGG COMPOUND |