EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | [NH3+]CCCCCC(=O)[O-] |
| InChI | InChI=1S/C6H13NO2/c7-5-3-1-2-4-6(8)9/h1-5,7H2,(H,8,9) |
| InChIKey | SLXKOJJOQWFEFD-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-aminohexanoic acid zwitterion (CHEBI:57826) is a amino-acid zwitterion (CHEBI:35238) |
| 6-aminohexanoic acid zwitterion (CHEBI:57826) is conjugate acid of 6-aminohexanoate (CHEBI:32396) |
| 6-aminohexanoic acid zwitterion (CHEBI:57826) is tautomer of 6-aminohexanoic acid (CHEBI:16586) |
| Incoming Relation(s) |
| 6-aminohexanoate (CHEBI:32396) is conjugate base of 6-aminohexanoic acid zwitterion (CHEBI:57826) |
| 6-aminohexanoic acid (CHEBI:16586) is tautomer of 6-aminohexanoic acid zwitterion (CHEBI:57826) |
| IUPAC Name |
|---|
| 6-azaniumylhexanoate |
| Synonym | Source |
|---|---|
| 6-ammoniohexanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-aminohexanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1043025 | Gmelin |