EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:37424 - sterol 3-β-D-glucoside
| Formula | |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 437.590 |
| Monoisotopic Mass (excl. R groups) | 437.29031 |
| SMILES | *C1CCC2C3CCC4CC(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)CCC4(C)C3CCC12C |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sterol 3-β-D-glucoside (CHEBI:37424) is a steroid saponin (CHEBI:61655) |
| sterol 3-β-D-glucoside (CHEBI:37424) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| (22E,24R)-5α,8α-epidioxyergosta-6,9,22-triene-3β-ol-3-O-β-D-glucopyranoside (CHEBI:65852) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| (25S)-5β-spirostan-3β-yl β-D-glucoside (CHEBI:15579) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| 16,17-didehydropregnenolone 3-β-D-glucoside (CHEBI:145050) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| 16,23-epoxy-5β-cholestane triglycoside (CHEBI:65855) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| 24-methylenecholesteryl β-D-glucoside (CHEBI:145114) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| 25-acyl-27-norcholesteryl β-D-glucoside (CHEBI:142576) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| 3β-hydroxy-16α,17α-epoxypregnenolone 3-β-D-glucoside (CHEBI:145046) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| brassicasterol 3-β-D-glucoside (CHEBI:145041) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| campesterol 3-β-D-glucoside (CHEBI:145072) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| cholesteryl β-D-glucoside (CHEBI:17495) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| dehydroepiandrosterone 3-β-D-glucoside (CHEBI:145051) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| diosgenin 3-O-β-D-glucoside (CHEBI:74020) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| epiandrosterone 3-β-D-glucoside (CHEBI:145048) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| pregnenolone 3-β-D-glucoside (CHEBI:145044) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| solasodine 3-β-D-glucoside (CHEBI:229720) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| tigogenin 3-O-β-D-glucopyranoside (CHEBI:166995) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| tomatidine 3-O-β-D-glucopyranoside(1+) (CHEBI:166998) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| γ-chaconine(1+) (CHEBI:166997) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| Synonyms | Source |
|---|---|
| Sterol 3-beta-D-glucoside | KEGG COMPOUND |
| sterol 3-β-D-glucoside | ChEBI |
| sterol 3-β-D-glucosides | ChEBI |
| UniProt Name | Source |
|---|---|
| a sterol 3-β-D-glucoside | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03641 | KEGG COMPOUND |
| Sterol-3-beta-D-glucosides | MetaCyc |