EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H52O8 |
| Net Charge | 0 |
| Average Mass | 588.782 |
| Monoisotopic Mass | 588.36622 |
| SMILES | [H][C@@]1(O[C@H]2CC[C@]3(C)C4=CC[C@@]5(C)[C@@]([H])(CC[C@]5([H])[C@H](C)/C=C/[C@H](C)C(C)C)[C@@]45C=C[C@]3(C2)OO5)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C34H52O8/c1-19(2)20(3)7-8-21(4)23-9-10-25-31(23,5)13-12-26-32(6)14-11-22(17-33(32)15-16-34(25,26)42-41-33)39-30-29(38)28(37)27(36)24(18-35)40-30/h7-8,12,15-16,19-25,27-30,35-38H,9-11,13-14,17-18H2,1-6H3/b8-7+/t20-,21+,22-,23+,24+,25+,27+,28-,29+,30+,31+,32+,33+,34-/m0/s1 |
| InChIKey | PIUDVAYSOWOHCO-UFXGVOTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlorophyllum molybdites (ncbitaxon:34430) | fruit (BTO:0000486) | PubMed (11515573) |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (22E,24R)-5α,8α-epidioxyergosta-6,9,22-triene-3β-ol-3-O-β-D-glucopyranoside (CHEBI:65852) has role antineoplastic agent (CHEBI:35610) |
| (22E,24R)-5α,8α-epidioxyergosta-6,9,22-triene-3β-ol-3-O-β-D-glucopyranoside (CHEBI:65852) has role fungal metabolite (CHEBI:76946) |
| (22E,24R)-5α,8α-epidioxyergosta-6,9,22-triene-3β-ol-3-O-β-D-glucopyranoside (CHEBI:65852) is a cholestanoid (CHEBI:50401) |
| (22E,24R)-5α,8α-epidioxyergosta-6,9,22-triene-3β-ol-3-O-β-D-glucopyranoside (CHEBI:65852) is a monosaccharide derivative (CHEBI:63367) |
| (22E,24R)-5α,8α-epidioxyergosta-6,9,22-triene-3β-ol-3-O-β-D-glucopyranoside (CHEBI:65852) is a organic peroxide (CHEBI:25702) |
| (22E,24R)-5α,8α-epidioxyergosta-6,9,22-triene-3β-ol-3-O-β-D-glucopyranoside (CHEBI:65852) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| IUPAC Name |
|---|
| (3S,5S,8S,10R,13R,14R,17R)-17-[(2R,3E,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,3,4,10,12,13,14,15,16,17-decahydro-2H-5,8-epidioxycyclopenta[a]phenanthren-3-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9031469 | Reaxys |
| Citations |
|---|