EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:52973 - ergosteryl 3-β-D-glucoside
| Formula | C34H54O6 |
| Net Charge | 0 |
| Average Mass | 558.800 |
| Monoisotopic Mass | 558.39204 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC[C@@]1([H])C2=CC=C2C[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@@]21C |
| InChI | InChI=1S/C34H54O6/c1-19(2)20(3)7-8-21(4)25-11-12-26-24-10-9-22-17-23(13-15-33(22,5)27(24)14-16-34(25,26)6)39-32-31(38)30(37)29(36)28(18-35)40-32/h7-10,19-21,23,25-32,35-38H,11-18H2,1-6H3/b8-7+/t20-,21+,23-,25+,26-,27-,28+,29+,30-,31+,32+,33-,34+/m0/s1 |
| InChIKey | MKZPNGBJJJZJMI-GBLVNJONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) has functional parent ergosterol (CHEBI:16933) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) has role metabolite (CHEBI:25212) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) is a monosaccharide derivative (CHEBI:63367) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| IUPAC Name |
|---|
| (3β,22E)-ergosta-5,7,22-trien-3-yl β-D-glucopyranoside |
| UniProt Name | Source |
|---|---|
| ergosteryl 3-β-D-glucoside | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:66840 | Beilstein |