EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H54O6 |
| Net Charge | 0 |
| Average Mass | 558.800 |
| Monoisotopic Mass | 558.39204 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC[C@@]1([H])C2=CC=C2C[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@@]21C |
| InChI | InChI=1S/C34H54O6/c1-19(2)20(3)7-8-21(4)25-11-12-26-24-10-9-22-17-23(13-15-33(22,5)27(24)14-16-34(25,26)6)39-32-31(38)30(37)29(36)28(18-35)40-32/h7-10,19-21,23,25-32,35-38H,11-18H2,1-6H3/b8-7+/t20-,21+,23-,25+,26-,27-,28+,29+,30-,31+,32+,33-,34+/m0/s1 |
| InChIKey | MKZPNGBJJJZJMI-GBLVNJONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) has functional parent ergosterol (CHEBI:16933) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) has role metabolite (CHEBI:25212) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) is a monosaccharide derivative (CHEBI:63367) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| IUPAC Name |
|---|
| (3β,22E)-ergosta-5,7,22-trien-3-yl β-D-glucopyranoside |
| UniProt Name | Source |
|---|---|
| ergosteryl 3-β-D-glucoside | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:66840 | Beilstein |