EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H74O17 |
| Net Charge | 0 |
| Average Mass | 887.070 |
| Monoisotopic Mass | 886.49260 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@]2([H])O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@]2([H])O[C@H]2CC[C@@]3(C)[C@]([H])(CC[C@]4([H])[C@]3([H])CC[C@@]3(C)[C@@]4([H])C[C@]4([H])O[C@@H](C=C(C)C)[C@H](O)[C@@H](C)[C@]34[H])C2)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C45H74O17/c1-18(2)13-27-31(48)19(3)30-26(58-27)15-25-23-8-7-21-14-22(9-11-44(21,5)24(23)10-12-45(25,30)6)57-42-39(36(53)33(50)28(16-46)59-42)62-43-40(37(54)34(51)29(17-47)60-43)61-41-38(55)35(52)32(49)20(4)56-41/h13,19-43,46-55H,7-12,14-17H2,1-6H3/t19-,20-,21+,22-,23+,24-,25-,26-,27-,28+,29+,30-,31+,32-,33+,34+,35+,36-,37-,38+,39+,40+,41-,42+,43-,44-,45-/m0/s1 |
| InChIKey | AJNYRTVTKHEZMG-BYMWGYRGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ornithogalum saundersiae (ncbitaxon:484171) | bulb (BTO:0000159) | PubMed (7586067) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16,23-epoxy-5β-cholestane triglycoside (CHEBI:65855) has role antineoplastic agent (CHEBI:35610) |
| 16,23-epoxy-5β-cholestane triglycoside (CHEBI:65855) has role metabolite (CHEBI:25212) |
| 16,23-epoxy-5β-cholestane triglycoside (CHEBI:65855) is a 22-hydroxy steroid (CHEBI:36863) |
| 16,23-epoxy-5β-cholestane triglycoside (CHEBI:65855) is a cholestanoid (CHEBI:50401) |
| 16,23-epoxy-5β-cholestane triglycoside (CHEBI:65855) is a cyclic ether (CHEBI:37407) |
| 16,23-epoxy-5β-cholestane triglycoside (CHEBI:65855) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| 16,23-epoxy-5β-cholestane triglycoside (CHEBI:65855) is a trisaccharide derivative (CHEBI:63571) |
| IUPAC Name |
|---|
| (3β,5β,16β,22R,23S)-22-hydroxy-16,23-epoxycholest-24-en-3-yl 6-deoxy-α-L-mannopyranosyl-(1→2)-β-D-glucopyranosyl-(1→2)-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8184507 | Reaxys |
| Citations |
|---|