EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H56O6 |
| Net Charge | 0 |
| Average Mass | 560.816 |
| Monoisotopic Mass | 560.40769 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCC(=C)C(C)C |
| InChI | InChI=1S/C34H56O6/c1-19(2)20(3)7-8-21(4)25-11-12-26-24-10-9-22-17-23(13-15-33(22,5)27(24)14-16-34(25,26)6)39-32-31(38)30(37)29(36)28(18-35)40-32/h9,19,21,23-32,35-38H,3,7-8,10-18H2,1-2,4-6H3/t21-,23+,24+,25-,26+,27+,28-,29-,30+,31-,32-,33+,34-/m1/s1 |
| InChIKey | YQEUTOSZVKSYTM-UYRRFJMQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-methylenecholesteryl β-D-glucoside (CHEBI:145114) has functional parent 24-methylenecholesterol (CHEBI:19812) |
| 24-methylenecholesteryl β-D-glucoside (CHEBI:145114) is a monosaccharide derivative (CHEBI:63367) |
| 24-methylenecholesteryl β-D-glucoside (CHEBI:145114) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| IUPAC Name |
|---|
| (17R)-ergosta-5,24(28)-dien-3β-yl β-D-glucopyranoside |
| UniProt Name | Source |
|---|---|
| 24-methylene cholesteryl β-D-glucoside | UniProt |
| Citations |
|---|