EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O8 |
| Net Charge | 0 |
| Average Mass | 492.609 |
| Monoisotopic Mass | 492.27232 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@H]2O[C@]21C(C)=O |
| InChI | InChI=1S/C27H40O8/c1-13(29)27-20(35-27)11-18-16-5-4-14-10-15(6-8-25(14,2)17(16)7-9-26(18,27)3)33-24-23(32)22(31)21(30)19(12-28)34-24/h4,15-24,28,30-32H,5-12H2,1-3H3/t15-,16+,17-,18-,19+,20+,21+,22-,23+,24+,25-,26-,27+/m0/s1 |
| InChIKey | SQOBYKQKYDLAPW-JTUWGOFYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-hydroxy-16α,17α-epoxypregnenolone 3-β-D-glucoside (CHEBI:145046) has functional parent 3β-hydroxy-16α,17α-epoxypregnenolone (CHEBI:145045) |
| 3β-hydroxy-16α,17α-epoxypregnenolone 3-β-D-glucoside (CHEBI:145046) is a 20-oxo steroid (CHEBI:36885) |
| 3β-hydroxy-16α,17α-epoxypregnenolone 3-β-D-glucoside (CHEBI:145046) is a epoxy steroid (CHEBI:145217) |
| 3β-hydroxy-16α,17α-epoxypregnenolone 3-β-D-glucoside (CHEBI:145046) is a methyl ketone (CHEBI:51867) |
| 3β-hydroxy-16α,17α-epoxypregnenolone 3-β-D-glucoside (CHEBI:145046) is a monosaccharide derivative (CHEBI:63367) |
| 3β-hydroxy-16α,17α-epoxypregnenolone 3-β-D-glucoside (CHEBI:145046) is a sterol 3-β-D-glucoside (CHEBI:37424) |
| IUPAC Name |
|---|
| 20-oxo-16α-16,17-epoxypregn-5-en-3β-yl β-D-glucopyranoside |
| UniProt Name | Source |
|---|---|
| 3β-hydroxy-16α,17α-epoxypregnenolone 3-β-D-glucoside | UniProt |
| Citations |
|---|