EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:17217 - 2-butenoic acid
| Formula | C4H6O2 |
| Net Charge | 0 |
| Average Mass | 86.090 |
| Monoisotopic Mass | 86.03678 |
| SMILES | [H]C(C)=CC(=O)O |
| InChI | InChI=1S/C4H6O2/c1-2-3-4(5)6/h2-3H,1H3,(H,5,6) |
| InChIKey | LDHQCZJRKDOVOX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-butenoic acid (CHEBI:17217) is a butenoic acid (CHEBI:22959) |
| 2-butenoic acid (CHEBI:17217) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 2-butenoic acid (CHEBI:17217) is conjugate acid of but-2-enoate (CHEBI:36258) |
| Incoming Relation(s) |
| (Z)-2-aminobutenoic acid (CHEBI:18820) has functional parent 2-butenoic acid (CHEBI:17217) |
| 2-aminobut-2-enoic acid (CHEBI:48305) has functional parent 2-butenoic acid (CHEBI:17217) |
| 2-hydroxy-4-(1-oxo-1,3-dihydro-2H-inden-2-ylidene) but-2-enoic acid (CHEBI:19608) has functional parent 2-butenoic acid (CHEBI:17217) |
| 2-hydroxy-4-(2-oxo-1,3-dihydro-2H-inden-1-ylidene) but-2-enoic acid (CHEBI:19609) has functional parent 2-butenoic acid (CHEBI:17217) |
| 2-methylbut-2-enoic acid (CHEBI:36432) has functional parent 2-butenoic acid (CHEBI:17217) |
| 3-methylbut-2-enoic acid (CHEBI:37127) has functional parent 2-butenoic acid (CHEBI:17217) |
| but-2-enoate ester (CHEBI:50654) has functional parent 2-butenoic acid (CHEBI:17217) |
| but-2-enoyl-CoA (CHEBI:36926) has functional parent 2-butenoic acid (CHEBI:17217) |
| methyl 3-hydroxybut-2-enoate (CHEBI:38726) has functional parent 2-butenoic acid (CHEBI:17217) |
| crotonic acid (CHEBI:41131) is a 2-butenoic acid (CHEBI:17217) |
| isocrotonic acid (CHEBI:36253) is a 2-butenoic acid (CHEBI:17217) |
| but-2-enoate (CHEBI:36258) is conjugate base of 2-butenoic acid (CHEBI:17217) |
| IUPAC Name |
|---|
| but-2-enoic acid |
| Synonyms | Source |
|---|---|
| 2-butenic acid | ChEBI |
| 2-Butenoate | KEGG COMPOUND |
| 2-Butenoic acid | KEGG COMPOUND |
| 3-methylacrylic acid | ChemIDplus |
| acide crotonique | ChEBI |
| Crotonic acid | KEGG COMPOUND |