EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O2 |
| Net Charge | 0 |
| Average Mass | 114.144 |
| Monoisotopic Mass | 114.06808 |
| SMILES | [H]/C(C)=C/C(=O)OCC |
| InChI | InChI=1S/C6H10O2/c1-3-5-6(7)8-4-2/h3,5H,4H2,1-2H3/b5-3- |
| InChIKey | ZFDIRQKJPRINOQ-HYXAFXHYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl (2Z)-but-2-enoate (CHEBI:87334) has functional parent isocrotonic acid (CHEBI:36253) |
| ethyl (2Z)-but-2-enoate (CHEBI:87334) has role metabolite (CHEBI:25212) |
| ethyl (2Z)-but-2-enoate (CHEBI:87334) is a but-2-enoate ester (CHEBI:50654) |
| IUPAC Name |
|---|
| ethyl (2Z)-but-2-enoate |
| Synonym | Source |
|---|---|
| cis-ethyl crotonate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720419 | Reaxys |
| CAS:6776-19-8 | ChemIDplus |