EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5O2 |
| Net Charge | -1 |
| Average Mass | 85.082 |
| Monoisotopic Mass | 85.02950 |
| SMILES | [H]/C(C)=C/C(=O)[O-] |
| InChI | InChI=1S/C4H6O2/c1-2-3-4(5)6/h2-3H,1H3,(H,5,6)/p-1/b3-2- |
| InChIKey | LDHQCZJRKDOVOX-IHWYPQMZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isocrotonate (CHEBI:36254) is a but-2-enoate (CHEBI:36258) |
| isocrotonate (CHEBI:36254) is a short-chain fatty acid anion (CHEBI:58951) |
| isocrotonate (CHEBI:36254) is a unsaturated fatty acid anion (CHEBI:2580) |
| isocrotonate (CHEBI:36254) is conjugate base of isocrotonic acid (CHEBI:36253) |
| Incoming Relation(s) |
| isocrotonic acid (CHEBI:36253) is conjugate acid of isocrotonate (CHEBI:36254) |
| IUPAC Name |
|---|
| (2Z)-but-2-enoate |
| Synonyms | Source |
|---|---|
| (Z)-2-butenoate | ChEBI |
| cis-2-butenoate | ChEBI |
| (Z)-crotonate | ChEBI |
| cis-crotonate | ChEBI |