EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N |
| Net Charge | 0 |
| Average Mass | 227.351 |
| Monoisotopic Mass | 227.16740 |
| SMILES | [H][C@@]12CCCC[C@@]13CCN[C@@H]2Cc1ccccc13 |
| InChI | InChI=1S/C16H21N/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15/h1-2,5-6,14-15,17H,3-4,7-11H2/t14-,15+,16-/m0/s1 |
| InChIKey | INAXVFBXDYWQFN-XHSDSOJGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| morphinan (CHEBI:35649) is a isoquinoline alkaloid fundamental parent (CHEBI:38515) |
| morphinan (CHEBI:35649) is a morphinane alkaloid (CHEBI:25418) |
| Incoming Relation(s) |
| hydrocodone (CHEBI:5779) has parent hydride morphinan (CHEBI:35649) |
| hydromorphone (CHEBI:5790) has parent hydride morphinan (CHEBI:35649) |
| morphine (CHEBI:17303) has parent hydride morphinan (CHEBI:35649) |
| nalbuphine (CHEBI:7454) has parent hydride morphinan (CHEBI:35649) |
| naloxegol (CHEBI:82975) has parent hydride morphinan (CHEBI:35649) |
| naloxone (CHEBI:7459) has parent hydride morphinan (CHEBI:35649) |
| neopinone (CHEBI:7510) has parent hydride morphinan (CHEBI:35649) |
| oxycodone (CHEBI:7852) has parent hydride morphinan (CHEBI:35649) |
| salutaridine (CHEBI:17225) has parent hydride morphinan (CHEBI:35649) |
| salutaridinol (CHEBI:26600) has parent hydride morphinan (CHEBI:35649) |
| IUPAC Name |
|---|
| morphinan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1375527 | Beilstein |