EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO4 |
| Net Charge | 0 |
| Average Mass | 329.396 |
| Monoisotopic Mass | 329.16271 |
| SMILES | COC1=C[C@]23CCN(C)[C@H](Cc4ccc(OC)c(O)c42)C3=CC1O |
| InChI | InChI=1S/C19H23NO4/c1-20-7-6-19-10-16(24-3)14(21)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9-10,13-14,21-22H,6-8H2,1-3H3/t13-,14?,19+/m1/s1 |
| InChIKey | LLSADFZHWMEBHH-QWYDSHIESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salutaridinol (CHEBI:26600) has parent hydride morphinan (CHEBI:35649) |
| salutaridinol (CHEBI:26600) is a morphinane alkaloid (CHEBI:25418) |
| Incoming Relation(s) |
| (7R)-salutaridinol (CHEBI:38103) is a salutaridinol (CHEBI:26600) |
| (7S)-salutaridinol (CHEBI:18373) is a salutaridinol (CHEBI:26600) |
| IUPAC Name |
|---|
| 3,6-dimethoxy-17-methyl-5,6,8,14-tetradehydromorphinan-4,7-diol |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1552911 | Beilstein |