EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO4 |
| Net Charge | 0 |
| Average Mass | 327.380 |
| Monoisotopic Mass | 327.14706 |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C19H21NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,14,17,21,23H,1,5-10H2/t14-,17+,18+,19-/m1/s1 |
| InChIKey | UZHSEJADLWPNLE-GRGSLBFTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antidote to opioid poisoning A role borne by a molecule that acts to counteract or neutralise the deleterious effects of opioids. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naloxone (CHEBI:7459) has parent hydride morphinan (CHEBI:35649) |
| naloxone (CHEBI:7459) has role antidote to opioid poisoning (CHEBI:90755) |
| naloxone (CHEBI:7459) has role central nervous system depressant (CHEBI:35488) |
| naloxone (CHEBI:7459) has role μ-opioid receptor antagonist (CHEBI:50137) |
| naloxone (CHEBI:7459) is a morphinane alkaloid (CHEBI:25418) |
| naloxone (CHEBI:7459) is a organic heteropentacyclic compound (CHEBI:38164) |
| naloxone (CHEBI:7459) is a tertiary alcohol (CHEBI:26878) |
| naloxone (CHEBI:7459) is conjugate base of naloxone(1+) (CHEBI:90756) |
| Incoming Relation(s) |
| naloxegol (CHEBI:82975) has functional parent naloxone (CHEBI:7459) |
| naloxone(1+) (CHEBI:90756) is conjugate acid of naloxone (CHEBI:7459) |
| IUPAC Name |
|---|
| 3,14-dihydroxy-17-(prop-2-en-1-yl)-4,5α-epoxymorphinan-6-one |
| INNs | Source |
|---|---|
| naloxona | DrugBank |
| naloxone | ChemIDplus |
| naloxone | WHO MedNet |
| naloxonum | DrugBank |
| Synonyms | Source |
|---|---|
| 17-allyl-3,14-dihydroxy-4,5α-epoxymorphinan-6-one | ChEBI |
| 1-N-Allyl-14-hydroxynordihydromorphinone | ChemIDplus |
| (−)-naloxone | ChEBI |
| Citations |
|---|