EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H53NO11 |
| Net Charge | 0 |
| Average Mass | 651.794 |
| Monoisotopic Mass | 651.36186 |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](OCCOCCOCCOCCOCCOCCOCCOC)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C34H53NO11/c1-3-9-35-10-8-33-30-26-4-5-27(36)31(30)46-32(33)28(6-7-34(33,37)29(35)25-26)45-24-23-44-22-21-43-20-19-42-18-17-41-16-15-40-14-13-39-12-11-38-2/h3-5,28-29,32,36-37H,1,6-25H2,2H3/t28-,29+,32-,33-,34+/m0/s1 |
| InChIKey | XNKCCCKFOQNXKV-ZRSCBOBOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor cathartic Any substance that accelerates defecation. Compare with laxatives, which are substances that ease defecation (usually by softening faeces). A substance can be both a laxative and a cathartic. |
| Application: | mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naloxegol (CHEBI:82975) has functional parent naloxone (CHEBI:7459) |
| naloxegol (CHEBI:82975) has parent hydride morphinan (CHEBI:35649) |
| naloxegol (CHEBI:82975) has role cathartic (CHEBI:75325) |
| naloxegol (CHEBI:82975) has role μ-opioid receptor antagonist (CHEBI:50137) |
| naloxegol (CHEBI:82975) is a aromatic ether (CHEBI:35618) |
| naloxegol (CHEBI:82975) is a organic heteropentacyclic compound (CHEBI:38164) |
| naloxegol (CHEBI:82975) is a phenols (CHEBI:33853) |
| naloxegol (CHEBI:82975) is a polyether (CHEBI:46774) |
| naloxegol (CHEBI:82975) is a tertiary alcohol (CHEBI:26878) |
| INN | Source |
|---|---|
| naloxegol | KEGG DRUG |
| Synonyms | Source |
|---|---|
| NKTR 118 | ChemIDplus |
| NKTR-118 | ChemIDplus |
| NKTR118 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14435712 | Reaxys |
| CAS:854601-70-0 | KEGG DRUG |
| CAS:854601-70-0 | ChemIDplus |
| Citations |
|---|