EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO4 |
| Net Charge | 0 |
| Average Mass | 315.369 |
| Monoisotopic Mass | 315.14706 |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(O)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C18H21NO4/c1-19-8-7-17-14-10-3-4-12(22-2)15(14)23-16(17)11(20)5-6-18(17,21)13(19)9-10/h3-4,13,16,21H,5-9H2,1-2H3/t13-,16+,17+,18-/m1/s1 |
| InChIKey | BRUQQQPBMZOVGD-XFKAJCMBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxycodone (CHEBI:7852) has functional parent thebaine (CHEBI:9519) |
| oxycodone (CHEBI:7852) has parent hydride morphinan (CHEBI:35649) |
| oxycodone (CHEBI:7852) has role antitussive (CHEBI:51177) |
| oxycodone (CHEBI:7852) has role opioid analgesic (CHEBI:35482) |
| oxycodone (CHEBI:7852) has role μ-opioid receptor agonist (CHEBI:55322) |
| oxycodone (CHEBI:7852) is a organic heteropentacyclic compound (CHEBI:38164) |
| oxycodone (CHEBI:7852) is a semisynthetic derivative (CHEBI:72588) |
| oxycodone (CHEBI:7852) is conjugate base of oxycodone(1+) (CHEBI:134686) |
| Incoming Relation(s) |
| oxycodone(1+) (CHEBI:134686) is conjugate acid of oxycodone (CHEBI:7852) |
| IUPAC Name |
|---|
| 14-hydroxy-3-methoxy-17-methyl-4,5α-epoxymorphinan-6-one |
| INNs | Source |
|---|---|
| oxicodona | WHO MedNet |
| oxycodone | WHO MedNet |
| oxycodone | ChemIDplus |
| oxycodonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (-)-14-Hydroxydihydrocodeinone | ChemIDplus |
| 4,5-Epoxy-14-hydroxy-3-methoxy-17-methylmorphinan-6-one | ChemIDplus |
| 4,5α-Epoxy-14-hydroxy-3-methoxy-17-methylmorphinan-6-one | ChemIDplus |
| Dihydro-14-hydroxycodeinone | ChemIDplus |
| Dihydrohydroxycodeinone | ChemIDplus |
| Dihydroxycodeinone | ChemIDplus |
| Citations |
|---|