EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5790 - hydromorphone
| Formula | C17H19NO3 |
| Net Charge | 0 |
| Average Mass | 285.343 |
| Monoisotopic Mass | 285.13649 |
| SMILES | [H][C@@]12CCC(=O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2,4,10-11,16,19H,3,5-8H2,1H3/t10-,11+,16-,17-/m0/s1 |
| InChIKey | WVLOADHCBXTIJK-YNHQPCIGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydromorphone (CHEBI:5790) has parent hydride morphinan (CHEBI:35649) |
| hydromorphone (CHEBI:5790) has role opioid analgesic (CHEBI:35482) |
| hydromorphone (CHEBI:5790) has role μ-opioid receptor agonist (CHEBI:55322) |
| hydromorphone (CHEBI:5790) is a morphinane alkaloid (CHEBI:25418) |
| hydromorphone (CHEBI:5790) is a organic heteropentacyclic compound (CHEBI:38164) |
| Incoming Relation(s) |
| hydromorphone hydrochloride (CHEBI:5791) has part hydromorphone (CHEBI:5790) |
| IUPAC Name |
|---|
| 3-hydroxy-17-methyl-4,5α-epoxymorphinan-6-one |
| INNs | Source |
|---|---|
| hydromorphone | ChemIDplus |
| hydromorphone | WHO MedNet |
| hidromorfona | WHO MedNet |
| hydromorphonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Hydromorphone | KEGG COMPOUND |
| (-)-(5R)-4,5-Epoxy-3-hydroxy-9α-methylmorphinan-6-one | ChemIDplus |
| 4,5-Epoxy-3-hydroxy-17-methylmorphinan-6-one | ChemIDplus |
| 4,5alpha-Epoxy-3-hydroxy-17-methyl-6-morphinanone | ChemIDplus |
| 6-Deoxy-7,8-dihydro-6-oxomorphine | ChemIDplus |
| 7,8-Dihydromorphinone | ChemIDplus |
| Citations |
|---|