EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2S |
| Net Charge | 0 |
| Average Mass | 121.161 |
| Monoisotopic Mass | 121.01975 |
| SMILES | [NH3+][C@H](CS)C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m1/s1 |
| InChIKey | XUJNEKJLAYXESH-UWTATZPHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-cysteine zwitterion (CHEBI:35236) is a cysteine zwitterion (CHEBI:35237) |
| D-cysteine zwitterion (CHEBI:35236) is conjugate acid of D-cysteinate(1−) (CHEBI:32449) |
| D-cysteine zwitterion (CHEBI:35236) is conjugate base of D-cysteinium (CHEBI:32451) |
| D-cysteine zwitterion (CHEBI:35236) is enantiomer of L-cysteine zwitterion (CHEBI:35235) |
| D-cysteine zwitterion (CHEBI:35236) is tautomer of D-cysteine (CHEBI:16375) |
| Incoming Relation(s) |
| D-cysteinium (CHEBI:32451) is conjugate acid of D-cysteine zwitterion (CHEBI:35236) |
| D-cysteinate(1−) (CHEBI:32449) is conjugate base of D-cysteine zwitterion (CHEBI:35236) |
| L-cysteine zwitterion (CHEBI:35235) is enantiomer of D-cysteine zwitterion (CHEBI:35236) |
| D-cysteine (CHEBI:16375) is tautomer of D-cysteine zwitterion (CHEBI:35236) |
| IUPAC Name |
|---|
| (2S)-2-ammonio-3-sulfanylpropanoate |
| Synonyms | Source |
|---|---|
| (2S)-2-ammonio-3-mercaptopropanoate | ChEBI |
| D-cysteine zwitterion | IUPAC |
| UniProt Name | Source |
|---|---|
| D-cysteine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2352354 | Gmelin |