EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2S |
| Net Charge | 0 |
| Average Mass | 121.161 |
| Monoisotopic Mass | 121.01975 |
| SMILES | [NH3+]C(CS)C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
| InChIKey | XUJNEKJLAYXESH-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cysteine zwitterion (CHEBI:35237) is a amino-acid zwitterion (CHEBI:35238) |
| cysteine zwitterion (CHEBI:35237) is conjugate acid of cysteinate(1−) (CHEBI:32456) |
| cysteine zwitterion (CHEBI:35237) is conjugate base of cysteinium (CHEBI:32458) |
| cysteine zwitterion (CHEBI:35237) is tautomer of cysteine (CHEBI:15356) |
| Incoming Relation(s) |
| D-cysteine zwitterion (CHEBI:35236) is a cysteine zwitterion (CHEBI:35237) |
| L-cysteine zwitterion (CHEBI:35235) is a cysteine zwitterion (CHEBI:35237) |
| cysteinium (CHEBI:32458) is conjugate acid of cysteine zwitterion (CHEBI:35237) |
| cysteinate(1−) (CHEBI:32456) is conjugate base of cysteine zwitterion (CHEBI:35237) |
| cysteine (CHEBI:15356) is tautomer of cysteine zwitterion (CHEBI:35237) |
| IUPAC Name |
|---|
| 2-ammonio-3-sulfanylpropanoate |
| Synonyms | Source |
|---|---|
| 2-ammonio-3-mercaptopropanoate | ChEBI |
| cysteine zwitterion | IUPAC |
| +H3N‒CH(CH2SH)-COO− | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:49992 | Gmelin |