EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6NO2S |
| Net Charge | -1 |
| Average Mass | 120.153 |
| Monoisotopic Mass | 120.01247 |
| SMILES | N[C@H](CS)C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/p-1/t2-/m1/s1 |
| InChIKey | XUJNEKJLAYXESH-UWTATZPHSA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-cysteinate(1−) (CHEBI:32449) has role fundamental metabolite (CHEBI:78675) |
| D-cysteinate(1−) (CHEBI:32449) is a cysteinate(1−) (CHEBI:32456) |
| D-cysteinate(1−) (CHEBI:32449) is conjugate acid of D-cysteinate(2−) (CHEBI:32450) |
| D-cysteinate(1−) (CHEBI:32449) is conjugate base of D-cysteine (CHEBI:16375) |
| D-cysteinate(1−) (CHEBI:32449) is conjugate base of D-cysteine zwitterion (CHEBI:35236) |
| D-cysteinate(1−) (CHEBI:32449) is enantiomer of L-cysteinate(1−) (CHEBI:32442) |
| Incoming Relation(s) |
| D-cysteine (CHEBI:16375) is conjugate acid of D-cysteinate(1−) (CHEBI:32449) |
| D-cysteine zwitterion (CHEBI:35236) is conjugate acid of D-cysteinate(1−) (CHEBI:32449) |
| D-cysteinate(2−) (CHEBI:32450) is conjugate base of D-cysteinate(1−) (CHEBI:32449) |
| L-cysteinate(1−) (CHEBI:32442) is enantiomer of D-cysteinate(1−) (CHEBI:32449) |
| IUPAC Name |
|---|
| hydrogen D-cysteinate |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-mercaptopropanoate | ChEBI |
| (2S)-2-amino-3-sulfanylpropanoate | IUPAC |
| D-cysteinate(1−) | JCBN |
| D-cysteine monoanion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1006156 | Gmelin |