EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2S |
| Net Charge | 0 |
| Average Mass | 121.161 |
| Monoisotopic Mass | 121.01975 |
| SMILES | [NH3+][C@@H](CS)C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
| InChIKey | XUJNEKJLAYXESH-REOHCLBHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-cysteine zwitterion (CHEBI:35235) is a cysteine zwitterion (CHEBI:35237) |
| L-cysteine zwitterion (CHEBI:35235) is conjugate acid of L-cysteinate(1−) (CHEBI:32442) |
| L-cysteine zwitterion (CHEBI:35235) is conjugate base of L-cysteinium (CHEBI:32445) |
| L-cysteine zwitterion (CHEBI:35235) is enantiomer of D-cysteine zwitterion (CHEBI:35236) |
| L-cysteine zwitterion (CHEBI:35235) is tautomer of L-cysteine (CHEBI:17561) |
| Incoming Relation(s) |
| S-(5-histidyl)cysteine sulfoxide dizwitterion (CHEBI:82728) has functional parent L-cysteine zwitterion (CHEBI:35235) |
| L-lanthionine dizwitterion (CHEBI:178193) has functional parent L-cysteine zwitterion (CHEBI:35235) |
| L-cysteinium (CHEBI:32445) is conjugate acid of L-cysteine zwitterion (CHEBI:35235) |
| L-cysteinate(1−) (CHEBI:32442) is conjugate base of L-cysteine zwitterion (CHEBI:35235) |
| D-cysteine zwitterion (CHEBI:35236) is enantiomer of L-cysteine zwitterion (CHEBI:35235) |
| L-cysteine (CHEBI:17561) is tautomer of L-cysteine zwitterion (CHEBI:35235) |
| IUPAC Name |
|---|
| (2R)-2-ammonio-3-sulfanylpropanoate |
| Synonyms | Source |
|---|---|
| (2R)-2-ammonio-3-mercaptopropanoate | ChEBI |
| L-cysteine zwitterion | IUPAC |
| UniProt Name | Source |
|---|---|
| L-cysteine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:49993 | Gmelin |