EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8NO2S |
| Net Charge | +1 |
| Average Mass | 122.169 |
| Monoisotopic Mass | 122.02703 |
| SMILES | [NH3+][C@H](CS)C(=O)O |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/p+1/t2-/m1/s1 |
| InChIKey | XUJNEKJLAYXESH-UWTATZPHSA-O |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-cysteinium (CHEBI:32451) has role fundamental metabolite (CHEBI:78675) |
| D-cysteinium (CHEBI:32451) is a cysteinium (CHEBI:32458) |
| D-cysteinium (CHEBI:32451) is conjugate acid of D-cysteine (CHEBI:16375) |
| D-cysteinium (CHEBI:32451) is conjugate acid of D-cysteine zwitterion (CHEBI:35236) |
| D-cysteinium (CHEBI:32451) is enantiomer of L-cysteinium (CHEBI:32445) |
| Incoming Relation(s) |
| D-cysteine (CHEBI:16375) is conjugate base of D-cysteinium (CHEBI:32451) |
| D-cysteine zwitterion (CHEBI:35236) is conjugate base of D-cysteinium (CHEBI:32451) |
| L-cysteinium (CHEBI:32445) is enantiomer of D-cysteinium (CHEBI:32451) |
| IUPAC Name |
|---|
| D-cysteinium |
| Synonyms | Source |
|---|---|
| (1S)-1-carboxy-2-mercaptoethanaminium | ChEBI |
| (1S)-1-carboxy-2-sulfanylethanaminium | IUPAC |
| D-cysteine cation | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:363237 | Gmelin |