EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16375 - D-cysteine
| Formula | C3H7NO2S |
| Net Charge | 0 |
| Average Mass | 121.161 |
| Monoisotopic Mass | 121.01975 |
| SMILES | N[C@H](CS)C(=O)O |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m1/s1 |
| InChIKey | XUJNEKJLAYXESH-UWTATZPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-cysteine (CHEBI:16375) is a D-α-amino acid (CHEBI:16733) |
| D-cysteine (CHEBI:16375) is a cysteine (CHEBI:15356) |
| D-cysteine (CHEBI:16375) is conjugate acid of D-cysteinate(1−) (CHEBI:32449) |
| D-cysteine (CHEBI:16375) is conjugate base of D-cysteinium (CHEBI:32451) |
| D-cysteine (CHEBI:16375) is enantiomer of L-cysteine (CHEBI:17561) |
| D-cysteine (CHEBI:16375) is tautomer of D-cysteine zwitterion (CHEBI:35236) |
| Incoming Relation(s) |
| D-cysteine derivative (CHEBI:83835) has functional parent D-cysteine (CHEBI:16375) |
| D-cysteinyl radical (CHEBI:32738) has functional parent D-cysteine (CHEBI:16375) |
| D-cysteinium (CHEBI:32451) is conjugate acid of D-cysteine (CHEBI:16375) |
| D-cysteinate(1−) (CHEBI:32449) is conjugate base of D-cysteine (CHEBI:16375) |
| L-cysteine (CHEBI:17561) is enantiomer of D-cysteine (CHEBI:16375) |
| D-cystein-S-yl group (CHEBI:32794) is substituent group from D-cysteine (CHEBI:16375) |
| D-cysteine residue (CHEBI:29951) is substituent group from D-cysteine (CHEBI:16375) |
| D-cysteinyl group (CHEBI:32452) is substituent group from D-cysteine (CHEBI:16375) |
| D-cysteine zwitterion (CHEBI:35236) is tautomer of D-cysteine (CHEBI:16375) |
| IUPAC Name |
|---|
| D-cysteine |
| Synonyms | Source |
|---|---|
| D-Cysteine | KEGG COMPOUND |
| D-Amino-3-mercaptopropionic acid | KEGG COMPOUND |
| (2S)-2-amino-3-sulfanylpropanoic acid | IUPAC |
| (2S)-2-amino-3-mercaptopropanoic acid | JCBN |
| D-CYSTEINE | PDBeChem |
| (S)-2-amino-3-mercaptopropanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00793 | KEGG COMPOUND |
| DCY | PDBeChem |
| DB03201 | DrugBank |
| HMDB0003417 | HMDB |
| YMDB00913 | YMDB |
| ECMDB03417 | ECMDB |
| C00007323 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Gmelin:363236 | Gmelin |
| Reaxys:1721407 | Reaxys |
| CAS:921-01-7 | KEGG COMPOUND |
| CAS:921-01-7 | ChemIDplus |
| Citations |
|---|