EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2 |
| Net Charge | 0 |
| Average Mass | 108.144 |
| Monoisotopic Mass | 108.06875 |
| SMILES | Nc1ccccc1N |
| InChI | InChI=1S/C6H8N2/c7-5-3-1-2-4-6(5)8/h1-4H,7-8H2 |
| InChIKey | GEYOCULIXLDCMW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | electron donor A molecular entity that can transfer an electron to another molecular entity. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-phenylenediamine (CHEBI:34043) has parent hydride benzene (CHEBI:16716) |
| 1,2-phenylenediamine (CHEBI:34043) is a hydrogen donor (CHEBI:17499) |
| 1,2-phenylenediamine (CHEBI:34043) is a phenylenediamine (CHEBI:51402) |
| Incoming Relation(s) |
| 4-nitro-1,2-phenylenediamine (CHEBI:67116) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| benzimidazole precursor fungicide (CHEBI:87037) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| entinostat (CHEBI:132082) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| JSH-23 (CHEBI:131326) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| tacedinaline (CHEBI:90195) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| thiophanate (CHEBI:82060) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| thiophanate-methyl (CHEBI:35014) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| IUPAC Name |
|---|
| benzene-1,2-diamine |
| Synonyms | Source |
|---|---|
| 1,2-Diaminobenzene | KEGG COMPOUND |
| 2-Aminoaniline | ChemIDplus |
| 2-Phenylene diamine | KEGG COMPOUND |
| OPDA | ChemIDplus |
| o-Phenylenediamine | KEGG COMPOUND |
| phenylene-1,2-dimaine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14402 | KEGG COMPOUND |
| O-Phenylenediamine | Wikipedia |
| Citations |
|---|