EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N4O4S2 |
| Net Charge | 0 |
| Average Mass | 342.402 |
| Monoisotopic Mass | 342.04565 |
| SMILES | COC(=O)NC(=S)Nc1ccccc1NC(=S)NC(=O)OC |
| InChI | InChI=1S/C12H14N4O4S2/c1-19-11(17)15-9(21)13-7-5-3-4-6-8(7)14-10(22)16-12(18)20-2/h3-6H,1-2H3,(H2,13,15,17,21)(H2,14,16,18,22) |
| InChIKey | QGHREAKMXXNCOA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiophanate-methyl (CHEBI:35014) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| thiophanate-methyl (CHEBI:35014) has role antifungal agrochemical (CHEBI:86328) |
| thiophanate-methyl (CHEBI:35014) is a benzimidazole precursor fungicide (CHEBI:87037) |
| thiophanate-methyl (CHEBI:35014) is a carbamate ester (CHEBI:23003) |
| thiophanate-methyl (CHEBI:35014) is a carbamate fungicide (CHEBI:87061) |
| thiophanate-methyl (CHEBI:35014) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| dimethyl (1,2-phenylenedicarbamothioyl)biscarbamate |
| Synonyms | Source |
|---|---|
| 1,2-Di-(3-methoxycarbonyl-2-thioureido)benzene | KEGG COMPOUND |
| Methylthiophanate | ChemIDplus |
| 1,2-Bis(3-(methoxycarbonyl)-2-thioureido)benzene | ChemIDplus |
| 1,2-Bis(methoxycarbonylthioureido)benzene | ChemIDplus |
| Methylthiofanate | ChemIDplus |
| o-Bis(3-methoxycarbonyl-2-thioureido)benzene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14432 | KEGG COMPOUND |
| thiophanate-methyl | Alan Wood's Pesticides |
| 640 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:937942 | Reaxys |
| CAS:23564-05-8 | KEGG COMPOUND |
| CAS:23564-05-8 | ChemIDplus |
| Citations |
|---|