EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N3O2 |
| Net Charge | 0 |
| Average Mass | 269.304 |
| Monoisotopic Mass | 269.11643 |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C15H15N3O2/c1-10(19)17-12-8-6-11(7-9-12)15(20)18-14-5-3-2-4-13(14)16/h2-9H,16H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | VAZAPHZUAVEOMC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tacedinaline (CHEBI:90195) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| tacedinaline (CHEBI:90195) has role antineoplastic agent (CHEBI:35610) |
| tacedinaline (CHEBI:90195) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| tacedinaline (CHEBI:90195) is a acetamides (CHEBI:22160) |
| tacedinaline (CHEBI:90195) is a benzamides (CHEBI:22702) |
| tacedinaline (CHEBI:90195) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-acetamido-N-(2-aminophenyl)benzamide |
| INNs | Source |
|---|---|
| tacedinalina | ChemIDplus |
| tacedinaline | KEGG COMPOUND |
| Synonyms | Source |
|---|---|
| 4-(Acetylamino)-N-(2-aminophenyl)benzamide | ChemIDplus |
| Acetyldinaline | ChemIDplus |
| C.I. 994 | ChemIDplus |
| CI 994 | ChemIDplus |
| CI-994 | ChemIDplus |
| N-acetyldinaline | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8422586 | Reaxys |
| CAS:112522-64-2 | KEGG COMPOUND |
| CAS:112522-64-2 | ChemIDplus |
| Citations |
|---|