EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20N4O3 |
| Net Charge | 0 |
| Average Mass | 376.416 |
| Monoisotopic Mass | 376.15354 |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C21H20N4O3/c22-18-5-1-2-6-19(18)25-20(26)17-9-7-15(8-10-17)13-24-21(27)28-14-16-4-3-11-23-12-16/h1-12H,13-14,22H2,(H,24,27)(H,25,26) |
| InChIKey | INVTYAOGFAGBOE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| entinostat (CHEBI:132082) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| entinostat (CHEBI:132082) has role antineoplastic agent (CHEBI:35610) |
| entinostat (CHEBI:132082) has role apoptosis inducer (CHEBI:68495) |
| entinostat (CHEBI:132082) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| entinostat (CHEBI:132082) is a benzamides (CHEBI:22702) |
| entinostat (CHEBI:132082) is a carbamate ester (CHEBI:23003) |
| entinostat (CHEBI:132082) is a primary amino compound (CHEBI:50994) |
| entinostat (CHEBI:132082) is a pyridines (CHEBI:26421) |
| entinostat (CHEBI:132082) is a substituted aniline (CHEBI:48975) |
| Incoming Relation(s) |
| pyridin-3-ylmethyl {4-[(2-amino-4-fluorophenyl)carbamoyl]benzyl}carbamate (CHEBI:125311) has functional parent entinostat (CHEBI:132082) |
| IUPAC Name |
|---|
| pyridin-3-ylmethyl {4-[(2-aminophenyl)carbamoyl]benzyl}carbamate |
| INNs | Source |
|---|---|
| entinostat | WHO MedNet |
| entinostat | WHO MedNet |
| entinostat | WHO MedNet |
| entinostatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY 86-5274 | ChemIDplus |
| BAY86-5274 | ChemIDplus |
| N-(2-aminophenyl)-4-(N-(pyridin-3-ylmethoxycarbonyl)aminomethyl)benzamide | ChemIDplus |
| MS 27-275 | ChemIDplus |
| MS-27-275 | ChemIDplus |
| MS 275 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09338 | KEGG DRUG |
| Entinostat | Wikipedia |
| LSM-4811 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8442710 | Reaxys |
| CAS:209783-80-2 | ChemIDplus |
| CAS:209783-80-2 | KEGG DRUG |
| Citations |
|---|