EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2 |
| Net Charge | 0 |
| Average Mass | 240.350 |
| Monoisotopic Mass | 240.16265 |
| SMILES | Cc1ccc(NCCCc2ccccc2)c(N)c1 |
| InChI | InChI=1S/C16H20N2/c1-13-9-10-16(15(17)12-13)18-11-5-8-14-6-3-2-4-7-14/h2-4,6-7,9-10,12,18H,5,8,11,17H2,1H3 |
| InChIKey | YMFNPBSZFWXMAD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JSH-23 (CHEBI:131326) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| JSH-23 (CHEBI:131326) has role NF-κB inhibitor (CHEBI:73240) |
| JSH-23 (CHEBI:131326) is a diamine (CHEBI:23666) |
| JSH-23 (CHEBI:131326) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-methyl-N1-(3-phenylpropyl)benzene-1,2-diamine |
| Synonyms | Source |
|---|---|
| NF-κB activation inhibitor II | ChEBI |
| JSH 23 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-5897 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24398255 | Reaxys |
| CAS:749886-87-1 | ChemIDplus |
| Citations |
|---|