EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N4O4S2 |
| Net Charge | 0 |
| Average Mass | 370.456 |
| Monoisotopic Mass | 370.07695 |
| SMILES | CCOC(=O)NC(=S)Nc1ccccc1NC(=S)NC(=O)OCC |
| InChI | InChI=1S/C14H18N4O4S2/c1-3-21-13(19)17-11(23)15-9-7-5-6-8-10(9)16-12(24)18-14(20)22-4-2/h5-8H,3-4H2,1-2H3,(H2,15,17,19,23)(H2,16,18,20,24) |
| InChIKey | YFNCATAIYKQPOO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiophanate (CHEBI:82060) has functional parent 1,2-phenylenediamine (CHEBI:34043) |
| thiophanate (CHEBI:82060) has role antifungal drug (CHEBI:86327) |
| thiophanate (CHEBI:82060) is a benzimidazole precursor fungicide (CHEBI:87037) |
| thiophanate (CHEBI:82060) is a carbamate ester (CHEBI:23003) |
| thiophanate (CHEBI:82060) is a carbamate fungicide (CHEBI:87061) |
| thiophanate (CHEBI:82060) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| diethyl (1,2-phenylenedicarbamothioyl)biscarbamate |
| Synonyms | Source |
|---|---|
| 1,2-Bis(3-ethoxycarbonyl-2-thioureido) benzene | ChemIDplus |
| 1,2-Bis(3-(ethoxycarbonyl)-2-thioureido)benzene | ChemIDplus |
| 1,2-Di-(3-ethoxycarbonyl-2-thioureido)benzene | ChemIDplus |
| 4,4'-o-Phenylenebis(ethyl 3-thioallophanate) | NIST Chemistry WebBook |
| Diethyl 4,4'-o-phenylenebis(3-thioallophanate) | ChemIDplus |
| diethyl N,N'-[1,2-phenylenebis(azanediylcarbonothioyl)]dicarbamate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 2935 | PPDB |
| C18918 | KEGG COMPOUND |
| thiophanate | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:939969 | Reaxys |
| CAS:23564-06-9 | ChemIDplus |
| CAS:23564-06-9 | KEGG COMPOUND |
| CAS:23564-06-9 | NIST Chemistry WebBook |