EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:33198 - D-gluconic acid
| Formula | C6H12O7 |
| Net Charge | 0 |
| Average Mass | 196.155 |
| Monoisotopic Mass | 196.05830 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4+,5-/m1/s1 |
| InChIKey | RGHNJXZEOKUKBD-SQOUGZDYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium expansum (ncbitaxon:27334) | - | PubMed (24024763) |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-gluconic acid (CHEBI:33198) has role Penicillium metabolite (CHEBI:76964) |
| D-gluconic acid (CHEBI:33198) has role chelator (CHEBI:38161) |
| D-gluconic acid (CHEBI:33198) is a gluconic acid (CHEBI:24266) |
| D-gluconic acid (CHEBI:33198) is conjugate acid of D-gluconate (CHEBI:18391) |
| D-gluconic acid (CHEBI:33198) is enantiomer of L-gluconic acid (CHEBI:86359) |
| Incoming Relation(s) |
| N-acetyl-D-glucosaminic acid (CHEBI:16948) has functional parent D-gluconic acid (CHEBI:33198) |
| D-glucono-1,4-lactone (CHEBI:16165) has functional parent D-gluconic acid (CHEBI:33198) |
| D-glucono-1,5-lactone (CHEBI:16217) has functional parent D-gluconic acid (CHEBI:33198) |
| 2-amino-2-deoxy-D-gluconic acid (CHEBI:17784) has functional parent D-gluconic acid (CHEBI:33198) |
| 2-dehydro-D-gluconic acid (CHEBI:27469) has functional parent D-gluconic acid (CHEBI:33198) |
| 2-dehydro-3-deoxy-D-gluconic acid (CHEBI:17032) has functional parent D-gluconic acid (CHEBI:33198) |
| 2,5-didehydro-D-gluconic acid (CHEBI:18281) has functional parent D-gluconic acid (CHEBI:33198) |
| 3-dehydro-D-gluconic acid (CHEBI:85257) has functional parent D-gluconic acid (CHEBI:33198) |
| 3-dehydro-2-deoxy-D-gluconic acid (CHEBI:16622) has functional parent D-gluconic acid (CHEBI:33198) |
| 5-dehydro-D-gluconic acid (CHEBI:17426) has functional parent D-gluconic acid (CHEBI:33198) |
| 6-deoxy-6-sulfo-D-gluconic acid (CHEBI:88270) has functional parent D-gluconic acid (CHEBI:33198) |
| D-gluconate (CHEBI:18391) is conjugate base of D-gluconic acid (CHEBI:33198) |
| L-gluconic acid (CHEBI:86359) is enantiomer of D-gluconic acid (CHEBI:33198) |
| IUPAC Name |
|---|
| D-gluconic acid |
| Synonyms | Source |
|---|---|
| (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid | HMDB |
| Dextronic acid | ChemIDplus |
| D-gluco-Hexonic acid | KEGG COMPOUND |
| D-Gluconic acid | KEGG COMPOUND |
| Gluconic acid | ChemIDplus |
| GLUCONIC ACID | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 3264 | DrugCentral |
| C00007303 | KNApSAcK |
| C00257 | KEGG COMPOUND |
| GCO | PDBeChem |
| GLUCONATE | MetaCyc |
| Gluconic_acid | Wikipedia |
| HMDB0000625 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726055 | Reaxys |
| Gmelin:83545 | Gmelin |
| CAS:526-95-4 | ChemIDplus |
| CAS:526-95-4 | KEGG COMPOUND |
| Citations |
|---|