EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18391 - D-gluconate
| Formula | C6H11O7 |
| Net Charge | -1 |
| Average Mass | 195.147 |
| Monoisotopic Mass | 195.05103 |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3-,4+,5-/m1/s1 |
| InChIKey | RGHNJXZEOKUKBD-SQOUGZDYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-gluconate (CHEBI:18391) has role human metabolite (CHEBI:77746) |
| D-gluconate (CHEBI:18391) has role metabolite (CHEBI:25212) |
| D-gluconate (CHEBI:18391) is a gluconate (CHEBI:24265) |
| D-gluconate (CHEBI:18391) is conjugate base of D-gluconic acid (CHEBI:33198) |
| Incoming Relation(s) |
| N-acetyl-D-glucosaminate (CHEBI:38439) has functional parent D-gluconate (CHEBI:18391) |
| 2-amino-2-deoxy-D-gluconate (CHEBI:33805) has functional parent D-gluconate (CHEBI:18391) |
| 2-dehydro-D-gluconate (CHEBI:16808) has functional parent D-gluconate (CHEBI:18391) |
| 2,5-didehydro-D-gluconate (CHEBI:11449) has functional parent D-gluconate (CHEBI:18391) |
| 5-dehydro-2-deoxy-D-gluconate (CHEBI:16669) has functional parent D-gluconate (CHEBI:18391) |
| 6-phospho-D-gluconate (CHEBI:16863) has functional parent D-gluconate (CHEBI:18391) |
| calcium gluconate (CHEBI:3309) has part D-gluconate (CHEBI:18391) |
| sodium gluconate (CHEBI:84997) has part D-gluconate (CHEBI:18391) |
| D-gluconic acid (CHEBI:33198) is conjugate acid of D-gluconate (CHEBI:18391) |
| IUPAC Name |
|---|
| D-gluconate |
| Synonyms | Source |
|---|---|
| Glycogenate | HMDB |
| Glyconate | HMDB |
| 2,3,4,5,6-pentahydroxyhexanoate | HMDB |
| Maltonate | HMDB |
| Dextronate | HMDB |
| UniProt Name | Source |
|---|---|
| D-gluconate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00257 | KEGG COMPOUND |
| HMDB0000625 | HMDB |
| GLUCONATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:83544 | Gmelin |
| Reaxys:3906521 | Reaxys |
| Citations |
|---|