EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O9S |
| Net Charge | 0 |
| Average Mass | 260.220 |
| Monoisotopic Mass | 260.02020 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CS(=O)(=O)O |
| InChI | InChI=1S/C6H12O9S/c7-2(1-16(13,14)15)3(8)4(9)5(10)6(11)12/h2-5,7-10H,1H2,(H,11,12)(H,13,14,15)/t2-,3-,4+,5-/m1/s1 |
| InChIKey | SBCIXDBITAKZCS-SQOUGZDYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas putida (ncbitaxon:303) | - | PubMed (26195800) | Strain: SQ1 |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-deoxy-6-sulfo-D-gluconic acid (CHEBI:88270) has functional parent D-gluconic acid (CHEBI:33198) |
| 6-deoxy-6-sulfo-D-gluconic acid (CHEBI:88270) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 6-deoxy-6-sulfo-D-gluconic acid (CHEBI:88270) is a carbohydrate acid derivative (CHEBI:63436) |
| 6-deoxy-6-sulfo-D-gluconic acid (CHEBI:88270) is a carbohydrate sulfonate (CHEBI:38029) |
| 6-deoxy-6-sulfo-D-gluconic acid (CHEBI:88270) is conjugate acid of 6-deoxy-6-sulfo-D-gluconate(2−) (CHEBI:88093) |
| Incoming Relation(s) |
| 6-deoxy-6-sulfo-D-gluconate(2−) (CHEBI:88093) is conjugate base of 6-deoxy-6-sulfo-D-gluconic acid (CHEBI:88270) |
| IUPAC Name |
|---|
| 6-deoxy-6-sulfo-D-gluconic acid |
| Synonyms | Source |
|---|---|
| 6-deoxy-6-sulfogluconic acid | ChEBI |
| 6-deoxy-D-gluconic acid 6-sulfonate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-18482 | MetaCyc |
| Citations |
|---|