EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O7 |
| Net Charge | 0 |
| Average Mass | 196.155 |
| Monoisotopic Mass | 196.05830 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A1211h]/1/ |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4+,5-/m0/s1 |
| InChIKey | RGHNJXZEOKUKBD-KLVWXMOXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-gluconic acid (CHEBI:86359) is a gluconic acid (CHEBI:24266) |
| L-gluconic acid (CHEBI:86359) is enantiomer of D-gluconic acid (CHEBI:33198) |
| Incoming Relation(s) |
| 5-dehydro-L-gluconic acid (CHEBI:137932) has functional parent L-gluconic acid (CHEBI:86359) |
| D-gluconic acid (CHEBI:33198) is enantiomer of L-gluconic acid (CHEBI:86359) |
| IUPAC Name |
|---|
| L-gluconic acid |