EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O7 |
| Net Charge | 0 |
| Average Mass | 192.123 |
| Monoisotopic Mass | 192.02700 |
| SMILES | O=C(O)C(=O)[C@@H](O)[C@H](O)C(=O)CO |
| WURCS | WURCS=2.0/1,1,0/[AO12Oh]/1/ |
| InChI | InChI=1S/C6H8O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h3-4,7,9-10H,1H2,(H,12,13)/t3-,4+/m1/s1 |
| InChIKey | RXMWXENJQAINCC-DMTCNVIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-didehydro-D-gluconic acid (CHEBI:18281) has functional parent D-gluconic acid (CHEBI:33198) |
| 2,5-didehydro-D-gluconic acid (CHEBI:18281) has role Escherichia coli metabolite (CHEBI:76971) |
| 2,5-didehydro-D-gluconic acid (CHEBI:18281) is a diketoaldonic acid (CHEBI:33507) |
| 2,5-didehydro-D-gluconic acid (CHEBI:18281) is conjugate acid of 2,5-didehydro-D-gluconate (CHEBI:11449) |
| Incoming Relation(s) |
| 2,5-didehydro-D-gluconate (CHEBI:11449) is conjugate base of 2,5-didehydro-D-gluconic acid (CHEBI:18281) |
| IUPAC Name |
|---|
| D-threo-hexo-2,5-diulosonic acid |
| Synonyms | Source |
|---|---|
| 2,5-Diketogluconic acid | KEGG COMPOUND |
| 2,5-diketo-D-gluconic acid | ChEBI |
| 2,5-Dioxo-D-gluconic acid | ChemIDplus |
| D-threo-2,5-Hexodiulosonic acid | ChEBI |