EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H34O2 |
| Net Charge | 0 |
| Average Mass | 270.457 |
| Monoisotopic Mass | 270.25588 |
| SMILES | CCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C17H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H2,1H3,(H,18,19) |
| InChIKey | KEMQGTRYUADPNZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| IUPAC Name |
|---|
| heptadecanoic acid |
| Synonyms | Source |
|---|---|
| n-heptadecanoic acid | NIST Chemistry WebBook |
| n-heptadecoic acid | NIST Chemistry WebBook |
| n-heptadecylic acid | NIST Chemistry WebBook |
| margarinic acid | NIST Chemistry WebBook |
| margaric acid | ChemIDplus |
| Margarinsäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01010017 | LIPID MAPS |
| HMDB0002259 | HMDB |
| CPD-7830 | MetaCyc |
| Heptadecanoic_acid | Wikipedia |
| C00007426 | KNApSAcK |
| Citations |
|---|