EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28O3 |
| Net Charge | 0 |
| Average Mass | 280.408 |
| Monoisotopic Mass | 280.20384 |
| SMILES | CCCCCC(O)/C=C/C=C/C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C17H28O3/c1-2-3-10-13-16(18)14-11-8-6-4-5-7-9-12-15-17(19)20/h5-8,11,14,16,18H,2-4,9-10,12-13,15H2,1H3,(H,19,20)/b7-5+,8-6+,14-11+ |
| InChIKey | KUKJHGXXZWHSBG-GMPNNLDHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-HHTrE (CHEBI:72783) has functional parent heptadecanoic acid (CHEBI:32365) |
| 12-HHTrE (CHEBI:72783) has role metabolite (CHEBI:25212) |
| 12-HHTrE (CHEBI:72783) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 12-HHTrE (CHEBI:72783) is a long-chain fatty acid (CHEBI:15904) |
| 12-HHTrE (CHEBI:72783) is a trienoic fatty acid (CHEBI:73155) |
| Incoming Relation(s) |
| 12S-HHTrE (CHEBI:63977) is a 12-HHTrE (CHEBI:72783) |
| IUPAC Name |
|---|
| 12-hydroxyheptadeca-5,8,10-trienoic acid |
| Synonyms | Source |
|---|---|
| 12-hydroxy-5,8,10-heptadecatrienoic acid | LIPID MAPS |
| 12-HHT | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050195 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:50683-78-8 | ChemIDplus |