EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H34O3 |
| Net Charge | 0 |
| Average Mass | 286.456 |
| Monoisotopic Mass | 286.25079 |
| SMILES | CCCCCCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C17H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(18)17(19)20/h16,18H,2-15H2,1H3,(H,19,20) |
| InChIKey | KUZABABLVHWUGR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyheptadecanoic acid (CHEBI:84854) has functional parent heptadecanoic acid (CHEBI:32365) |
| 2-hydroxyheptadecanoic acid (CHEBI:84854) is a 2-hydroxy fatty acid (CHEBI:10283) |
| Incoming Relation(s) |
| 2-hydroxyheptadecanoyl-CoA (CHEBI:139022) has functional parent 2-hydroxyheptadecanoic acid (CHEBI:84854) |
| IUPAC Name |
|---|
| 2-hydroxyheptadecanoic acid |
| Synonym | Source |
|---|---|
| 2-hydroxymargaric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050052 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1786816 | Reaxys |
| CAS:25022-78-0 | ChemIDplus |
| Citations |
|---|