EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O2 |
| Net Charge | 0 |
| Average Mass | 284.484 |
| Monoisotopic Mass | 284.27153 |
| SMILES | CCCCCCCCCCCCCCC[C@H](C)C(=O)O |
| InChI | InChI=1S/C18H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18(19)20/h17H,3-16H2,1-2H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | IZUAKSAWRVFBPE-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-methylheptadecanoic acid (CHEBI:85218) has functional parent heptadecanoic acid (CHEBI:32365) |
| (2S)-2-methylheptadecanoic acid (CHEBI:85218) is a branched-chain saturated fatty acid (CHEBI:39417) |
| (2S)-2-methylheptadecanoic acid (CHEBI:85218) is a long-chain fatty acid (CHEBI:15904) |
| (2S)-2-methylheptadecanoic acid (CHEBI:85218) is a methyl-branched fatty acid (CHEBI:62499) |
| (2S)-2-methylheptadecanoic acid (CHEBI:85218) is conjugate acid of (2S)-2-methylheptadecanoate (CHEBI:84269) |
| Incoming Relation(s) |
| (2S)-2-methylheptadecanoate (CHEBI:84269) is conjugate base of (2S)-2-methylheptadecanoic acid (CHEBI:85218) |
| IUPAC Name |
|---|
| (2S)-2-methylheptadecanoic acid |