EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H33O2 |
| Net Charge | -1 |
| Average Mass | 269.449 |
| Monoisotopic Mass | 269.24860 |
| SMILES | CCCCCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C17H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H2,1H3,(H,18,19)/p-1 |
| InChIKey | KEMQGTRYUADPNZ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| margarate (CHEBI:32366) has role mammalian metabolite (CHEBI:75768) |
| margarate (CHEBI:32366) is a fatty acid anion 17:0 (CHEBI:78124) |
| margarate (CHEBI:32366) is a long-chain fatty acid anion (CHEBI:57560) |
| margarate (CHEBI:32366) is a straight-chain saturated fatty acid anion (CHEBI:58954) |
| margarate (CHEBI:32366) is conjugate base of heptadecanoic acid (CHEBI:32365) |
| Incoming Relation(s) |
| N-hexadecanoyl-1,2-diheptadecanoyl-sn-glycero-3-phosphoethanolamine(1−) (CHEBI:138220) has functional parent margarate (CHEBI:32366) |
| N-oleoyl-1,2-diheptadecanoyl-sn-glycero-3-phosphoethanolamine(1−) (CHEBI:138222) has functional parent margarate (CHEBI:32366) |
| heptadecanoic acid (CHEBI:32365) is conjugate acid of margarate (CHEBI:32366) |
| IUPAC Name |
|---|
| heptadecanoate |
| Synonyms | Source |
|---|---|
| (17:0) | ChEBI |
| CH3‒[CH2]15‒COO− | IUPAC |
| n-heptadecanoate | ChEBI |
| n-heptadecoate | ChEBI |
| n-heptadecylate | ChEBI |
| heptadecanoate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| heptadecanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-7830 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:386661 | Gmelin |