EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O2 |
| Net Charge | 0 |
| Average Mass | 284.484 |
| Monoisotopic Mass | 284.27153 |
| SMILES | CC(C)CCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O2/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20/h17H,3-16H2,1-2H3,(H,19,20) |
| InChIKey | XDOFQFKRPWOURC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (6033596) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-methylheptadecanoic acid (CHEBI:84896) has functional parent heptadecanoic acid (CHEBI:32365) |
| 16-methylheptadecanoic acid (CHEBI:84896) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 16-methylheptadecanoic acid (CHEBI:84896) is a long-chain fatty acid (CHEBI:15904) |
| 16-methylheptadecanoic acid (CHEBI:84896) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 16-methylheptadecanoic acid |
| Synonyms | Source |
|---|---|
| 16-methylmargaric acid | ChEBI |
| (+)-Isostearic acid | LIPID MAPS |
| Isooctadecanoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020014 | LIPID MAPS |
| HMDB0031066 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1782699 | Reaxys |
| CAS:2724-58-5 | ChemIDplus |
| Citations |
|---|