EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O |
| Net Charge | 0 |
| Average Mass | 188.230 |
| Monoisotopic Mass | 188.09496 |
| SMILES | Cc1cc(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C11H12N2O/c1-9-8-11(14)13(12(9)2)10-6-4-3-5-7-10/h3-8H,1-2H3 |
| InChIKey | VEQOALNAAJBPNY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. cyclooxygenase 3 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 3. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antipyrine (CHEBI:31225) has role antipyretic (CHEBI:35493) |
| antipyrine (CHEBI:31225) has role cyclooxygenase 3 inhibitor (CHEBI:73263) |
| antipyrine (CHEBI:31225) has role environmental contaminant (CHEBI:78298) |
| antipyrine (CHEBI:31225) has role non-narcotic analgesic (CHEBI:35481) |
| antipyrine (CHEBI:31225) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| antipyrine (CHEBI:31225) has role xenobiotic (CHEBI:35703) |
| antipyrine (CHEBI:31225) is a pyrazolone (CHEBI:83328) |
| Incoming Relation(s) |
| 1-(4-sulfophenyl)-3-carboxy-4-amino-5-oxopyrazole (CHEBI:59995) has functional parent antipyrine (CHEBI:31225) |
| 3-hydroxymethylantipyrine (CHEBI:145210) has functional parent antipyrine (CHEBI:31225) |
| 4-(5-carboxypentanamido)antipyrine (CHEBI:59041) has functional parent antipyrine (CHEBI:31225) |
| 4-(methylamino)antipyrine (CHEBI:73261) has functional parent antipyrine (CHEBI:31225) |
| 4-acetamidoantipyrine (CHEBI:83513) has functional parent antipyrine (CHEBI:31225) |
| 4-aminoantipyrine (CHEBI:59026) has functional parent antipyrine (CHEBI:31225) |
| 4-hydroxyantipyrine (CHEBI:232156) has functional parent antipyrine (CHEBI:31225) |
| metamizole (CHEBI:62088) has functional parent antipyrine (CHEBI:31225) |
| propyphenazone (CHEBI:135538) has functional parent antipyrine (CHEBI:31225) |
| IUPAC Name |
|---|
| 1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one |
| INNs | Source |
|---|---|
| fenazona | WHO MedNet |
| phenazone | KEGG DRUG |
| phénazone | WHO MedNet |
| phenazonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,2-Dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one | ChemIDplus |
| 2,3-Dimethyl-1-phenyl-5-pyrazolone | ChemIDplus |
| Antipyrine | KEGG COMPOUND |
| Antipyrine | KEGG DRUG |
| Phenazone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 861 | DrugCentral |
| Antipyrine | Wikipedia |
| C13244 | KEGG COMPOUND |
| D01776 | KEGG DRUG |
| DB01435 | DrugBank |
| HMDB0015503 | HMDB |
| LSM-3038 | LINCS |
| Citations |
|---|