EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3O4 |
| Net Charge | 0 |
| Average Mass | 331.372 |
| Monoisotopic Mass | 331.15321 |
| SMILES | Cc1c(NC(=O)CCCCC(=O)O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C17H21N3O4/c1-12-16(18-14(21)10-6-7-11-15(22)23)17(24)20(19(12)2)13-8-4-3-5-9-13/h3-5,8-9H,6-7,10-11H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | WQYHBTLOMGJLGK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(5-carboxypentanamido)antipyrine (CHEBI:59041) has functional parent adipamic acid (CHEBI:59042) |
| 4-(5-carboxypentanamido)antipyrine (CHEBI:59041) has functional parent antipyrine (CHEBI:31225) |
| 4-(5-carboxypentanamido)antipyrine (CHEBI:59041) is a dicarboxylic acid monoamide (CHEBI:35735) |
| 4-(5-carboxypentanamido)antipyrine (CHEBI:59041) is a monocarboxylic acid (CHEBI:25384) |
| 4-(5-carboxypentanamido)antipyrine (CHEBI:59041) is a pyrazolone (CHEBI:83328) |
| IUPAC Name |
|---|
| 6-[(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)amino]-6-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| Phenaz | ChEBI |
| N-antipyrinyladipamic acid | ChEBI |
| Citations |
|---|