EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9N3O6S |
| Net Charge | 0 |
| Average Mass | 299.264 |
| Monoisotopic Mass | 299.02121 |
| SMILES | NC1C(=O)N(c2ccc(S(=O)(=O)O)cc2)N=C1C(=O)O |
| InChI | InChI=1S/C10H9N3O6S/c11-7-8(10(15)16)12-13(9(7)14)5-1-3-6(4-2-5)20(17,18)19/h1-4,7H,11H2,(H,15,16)(H,17,18,19) |
| InChIKey | VBKMDGXBOWYWHE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-sulfophenyl)-3-carboxy-4-amino-5-oxopyrazole (CHEBI:59995) has functional parent antipyrine (CHEBI:31225) |
| 1-(4-sulfophenyl)-3-carboxy-4-amino-5-oxopyrazole (CHEBI:59995) is a amino acid (CHEBI:33709) |
| 1-(4-sulfophenyl)-3-carboxy-4-amino-5-oxopyrazole (CHEBI:59995) is a monocarboxylic acid (CHEBI:25384) |
| 1-(4-sulfophenyl)-3-carboxy-4-amino-5-oxopyrazole (CHEBI:59995) is a pyrazoles (CHEBI:26410) |
| 1-(4-sulfophenyl)-3-carboxy-4-amino-5-oxopyrazole (CHEBI:59995) is a sulfonic acid (CHEBI:29214) |
| IUPAC Name |
|---|
| 4-amino-5-oxo-1-(4-sulfophenyl)-4,5-dihydro-1H-pyrazole-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-Amino-5-oxo-1-(p-sulphophenyl)-2-pyrazoline-3-carboxylic acid | ChemIDplus |
| SCAOP | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:839911 | Reaxys |
| CAS:2508-84-1 | ChemIDplus |
| Citations |
|---|