EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N3O4S |
| Net Charge | 0 |
| Average Mass | 311.363 |
| Monoisotopic Mass | 311.09398 |
| SMILES | Cc1c(N(C)CS(=O)(=O)O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C13H17N3O4S/c1-10-12(14(2)9-21(18,19)20)13(17)16(15(10)3)11-7-5-4-6-8-11/h4-8H,9H2,1-3H3,(H,18,19,20) |
| InChIKey | LVWZTYCIRDMTEY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. cyclooxygenase 3 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 3. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. anti-inflammatory agent Any compound that has anti-inflammatory effects. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metamizole (CHEBI:62088) has functional parent antipyrine (CHEBI:31225) |
| metamizole (CHEBI:62088) has role anti-inflammatory agent (CHEBI:67079) |
| metamizole (CHEBI:62088) has role antipyretic (CHEBI:35493) |
| metamizole (CHEBI:62088) has role antirheumatic drug (CHEBI:35842) |
| metamizole (CHEBI:62088) has role cyclooxygenase 3 inhibitor (CHEBI:73263) |
| metamizole (CHEBI:62088) has role non-narcotic analgesic (CHEBI:35481) |
| metamizole (CHEBI:62088) has role peripheral nervous system drug (CHEBI:49110) |
| metamizole (CHEBI:62088) has role prodrug (CHEBI:50266) |
| metamizole (CHEBI:62088) is a amino sulfonic acid (CHEBI:37793) |
| metamizole (CHEBI:62088) is a pyrazoles (CHEBI:26410) |
| metamizole (CHEBI:62088) is conjugate acid of metamizole(1−) (CHEBI:62086) |
| Incoming Relation(s) |
| metamizole(1−) (CHEBI:62086) is conjugate base of metamizole (CHEBI:62088) |
| IUPAC Name |
|---|
| [(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)(methyl)amino]methanesulfonic acid |
| Synonyms | Source |
|---|---|
| [(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylamino]methanesulfonic acid | ChEBI |
| (antipyrinylmethylamino)methanesulfonic acid | ChEBI |
| N-(2,3-dimethyl-5-oxo-1-phenyl-3-pyrazolin-4-yl)-N-methylaminomethanesulfonic acid | ChEBI |
| metamizol | ChemIDplus |
| metamizolum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4659 | DrugCentral |
| D08188 | KEGG DRUG |
| DB04817 | DrugBank |
| HMDB0254502 | HMDB |
| LSM-5839 | LINCS |
| Metamizole | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:327442 | Reaxys |
| CAS:50567-35-6 | ChemIDplus |
| CAS:50567-35-6 | KEGG DRUG |
| Citations |
|---|