EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O |
| Net Charge | 0 |
| Average Mass | 230.311 |
| Monoisotopic Mass | 230.14191 |
| SMILES | Cc1c(C(C)C)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C14H18N2O/c1-10(2)13-11(3)15(4)16(14(13)17)12-8-6-5-7-9-12/h5-10H,1-4H3 |
| InChIKey | PXWLVJLKJGVOKE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propyphenazone (CHEBI:135538) has functional parent antipyrine (CHEBI:31225) |
| propyphenazone (CHEBI:135538) has role non-narcotic analgesic (CHEBI:35481) |
| propyphenazone (CHEBI:135538) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| propyphenazone (CHEBI:135538) has role peripheral nervous system drug (CHEBI:49110) |
| propyphenazone (CHEBI:135538) is a pyrazolone (CHEBI:83328) |
| IUPAC Name |
|---|
| 1,5-dimethyl-2-phenyl-4-(propan-2-yl)-1,2-dihydro-3H-pyrazol-3-one |
| INNs | Source |
|---|---|
| propifenazona | ChemIDplus |
| propyphenazone | ChemIDplus |
| propyphenazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-Phenyl-2,3-dimethyl-4-isopropyl-3-pyrazolin-5-one | ChemIDplus |
| 1-Phenyl-2,3-dimethyl-4-isopropylpyrazol-5-one | ChemIDplus |
| 4-Isopropyl-1,5-dimethyl-2-phenyl-1,2-dihydro-pyrazol-3-one | ChEMBL |
| 4-Isopropylantipyrine | ChemIDplus |
| Isopropylantipyrine | ChemIDplus |
| Isopropylphenazone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2309 | DrugCentral |
| D01380 | KEGG DRUG |
| Propyphenazone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:204533 | Reaxys |
| CAS:479-92-5 | ChemIDplus |
| Citations |
|---|